C11H18S — CID 130372048
(1Z,6Z)-2,3,4-trimethylcycloocta-1,6-diene-1-thiol (PubChem CID 130372048) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is (1Z,6Z)-2,3,4-trimethylcycloocta-1,6-diene-1-thiol.
| Compound Name | (1Z,6Z)-2,3,4-trimethylcycloocta-1,6-diene-1-thiol |
|---|---|
| PubChem CID | 130372048 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (1Z,6Z)-2,3,4-trimethylcycloocta-1,6-diene-1-thiol |
| SMILES | C/C1=C(\S)C/C=C\CC(C)C1C |
| InChI | InChI=1S/C11H18S/c1-8-6-4-5-7-11(12)10(3)9(8)2/h4-5,8-9,12H,6-7H2,1-3H3/b5-4-,11-10+ |
| InChIKey | QVMFIOMBBRKGOI-JWPKELMXSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|