C21H28FN5O2 — CID 130372432
2-[4-[(3R,5R)-3-ethenyl-5-methylmorpholin-4-yl]-4,5-dihydropyrimidine-6-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline (PubChem CID 130372432) has the molecular formula C21H28FN5O2 and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-[4-[(3R,5R)-3-ethenyl-5-methylmorpholin-4-yl]-4,5-dihydropyrimidine-6-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline.
| Compound Name | 2-[4-[(3R,5R)-3-ethenyl-5-methylmorpholin-4-yl]-4,5-dihydropyrimidine-6-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 130372432 |
| Molecular Formula | C21H28FN5O2 |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 2-[4-[(3R,5R)-3-ethenyl-5-methylmorpholin-4-yl]-4,5-dihydropyrimidine-6-carboximidoyl]-5-fluoro-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(\C1=NC=NC(N2[C@H](C)COC[C@H]2C=C)C1)c1cc(OC(C)C)c(F)cc1N |
| InChI | InChI=1S/C21H28FN5O2/c1-5-14-10-28-9-13(4)27(14)20-8-18(25-11-26-20)21(24)15-6-19(29-12(2)3)16(22)7-17(15)23/h5-7,11-14,20,24H,1,8-10,23H2,2-4H3/b24-21-/t13-,14-,20?/m1/s1 |
| InChIKey | SMEXOOJYDHGMJY-NEVKUOJPSA-N |
| XLogP | 3.04 |
| TPSA | 96.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|