C12H20O — CID 130372719
2-[(1E)-2,3-dimethylbuta-1,3-dienoxy]hex-1-ene (PubChem CID 130372719) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-[(1E)-2,3-dimethylbuta-1,3-dienoxy]hex-1-ene.
| Compound Name | 2-[(1E)-2,3-dimethylbuta-1,3-dienoxy]hex-1-ene |
|---|---|
| PubChem CID | 130372719 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2-[(1E)-2,3-dimethylbuta-1,3-dienoxy]hex-1-ene |
| SMILES | C=C(CCCC)O/C=C(\C)C(=C)C |
| InChI | InChI=1S/C12H20O/c1-6-7-8-12(5)13-9-11(4)10(2)3/h9H,2,5-8H2,1,3-4H3/b11-9+ |
| InChIKey | FDHYGHATGGGXKM-PKNBQFBNSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|