C14H25N — CID 130372814
(3E,5Z)-5-methyl-N,N-dipropylhepta-1,3,5-trien-4-amine (PubChem CID 130372814) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (3E,5Z)-5-methyl-N,N-dipropylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5Z)-5-methyl-N,N-dipropylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 130372814 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (3E,5Z)-5-methyl-N,N-dipropylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(C(\C)=C/C)/N(CCC)CCC |
| InChI | InChI=1S/C14H25N/c1-6-10-14(13(5)9-4)15(11-7-2)12-8-3/h6,9-10H,1,7-8,11-12H2,2-5H3/b13-9-,14-10+ |
| InChIKey | HAQRYSWUWDHUEF-ZKLMZBBOSA-N |
| XLogP | 4.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|