C13H25NO3 — CID 130372927
1-[(2E,4E)-5-(2-aminoethoxy)hexa-2,4-dien-3-yl]oxy-3-methylbutan-2-ol (PubChem CID 130372927) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-[(2E,4E)-5-(2-aminoethoxy)hexa-2,4-dien-3-yl]oxy-3-methylbutan-2-ol.
| Compound Name | 1-[(2E,4E)-5-(2-aminoethoxy)hexa-2,4-dien-3-yl]oxy-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 130372927 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-[(2E,4E)-5-(2-aminoethoxy)hexa-2,4-dien-3-yl]oxy-3-methylbutan-2-ol |
| SMILES | C/C=C(\C=C(/C)OCCN)OCC(O)C(C)C |
| InChI | InChI=1S/C13H25NO3/c1-5-12(8-11(4)16-7-6-14)17-9-13(15)10(2)3/h5,8,10,13,15H,6-7,9,14H2,1-4H3/b11-8+,12-5+ |
| InChIKey | XAAXKNBNRVFSIC-OEBNHILSSA-N |
| XLogP | 1.80 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|