C19H31NO3 — CID 130373149
methyl (3E,5E)-9-amino-4-(cyclohexylmethoxy)-6-methyl-2-methylidenenona-3,5-dienoate (PubChem CID 130373149) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is methyl (3E,5E)-9-amino-4-(cyclohexylmethoxy)-6-methyl-2-methylidenenona-3,5-dienoate.
| Compound Name | methyl (3E,5E)-9-amino-4-(cyclohexylmethoxy)-6-methyl-2-methylidenenona-3,5-dienoate |
|---|---|
| PubChem CID | 130373149 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | methyl (3E,5E)-9-amino-4-(cyclohexylmethoxy)-6-methyl-2-methylidenenona-3,5-dienoate |
| SMILES | C=C(/C=C(\C=C(/C)CCCN)OCC1CCCCC1)C(=O)OC |
| InChI | InChI=1S/C19H31NO3/c1-15(8-7-11-20)12-18(13-16(2)19(21)22-3)23-14-17-9-5-4-6-10-17/h12-13,17H,2,4-11,14,20H2,1,3H3/b15-12+,18-13+ |
| InChIKey | KVSLKKRQHDCKMY-PYEASBQRSA-N |
| XLogP | 3.88 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|