About 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate
2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate (PubChem CID 130373332) has the molecular formula C14H17NO8
and a molecular weight of 327.29 g/mol. Its IUPAC name is 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate.
Molecular Properties
| Compound Name | 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate |
| PubChem CID | 130373332 |
| Molecular Formula | C14H17NO8 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate |
| SMILES | C=CC(=O)ON1C(=O)CC(CC(=O)OCCOC(=O)CC)C1=O |
| InChI | InChI=1S/C14H17NO8/c1-3-11(17)21-5-6-22-13(19)8-9-7-10(16)15(14(9)20)23-12(18)4-2/h4,9H,2-3,5-8H2,1H3 |
| InChIKey | AGZJOXILCMTWIY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate?
The IUPAC name of 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate (CID 130373332) is 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate.
What is the SMILES notation for 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate?
The canonical SMILES for 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate is C=CC(=O)ON1C(=O)CC(CC(=O)OCCOC(=O)CC)C1=O.
What is the InChIKey of 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate?
The InChIKey is AGZJOXILCMTWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO8/c1-3-11(17)21-5-6-22-13(19)8-9-7-10(16)15(14(9)20)23-12(18)4-2/h4,9H,2-3,5-8H2,1H3.
What are the key properties of 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate?
2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate has a molecular weight of 327.29 g/mol, XLogP of -0.11, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,5-dioxo-1-prop-2-enoyloxypyrrolidin-3-yl)acetyl]oxyethyl propanoate is sourced from PubChem (CID 130373332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).