C20H21N3 — CID 130373377
1-(3-methylphenyl)-N-[[5-(4-methylphenyl)pyrimidin-2-yl]methyl]methanamine (PubChem CID 130373377) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-[[5-(4-methylphenyl)pyrimidin-2-yl]methyl]methanamine.
| Compound Name | 1-(3-methylphenyl)-N-[[5-(4-methylphenyl)pyrimidin-2-yl]methyl]methanamine |
|---|---|
| PubChem CID | 130373377 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-(3-methylphenyl)-N-[[5-(4-methylphenyl)pyrimidin-2-yl]methyl]methanamine |
| SMILES | Cc1ccc(-c2cnc(CNCc3cccc(C)c3)nc2)cc1 |
| InChI | InChI=1S/C20H21N3/c1-15-6-8-18(9-7-15)19-12-22-20(23-13-19)14-21-11-17-5-3-4-16(2)10-17/h3-10,12-13,21H,11,14H2,1-2H3 |
| InChIKey | LSNPDRVLEBCBOU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |