About (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine
(Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine (PubChem CID 130373777) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine |
| PubChem CID | 130373777 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine |
| SMILES | C=NC/C=C\N(C)C |
| InChI | InChI=1S/C6H12N2/c1-7-5-4-6-8(2)3/h4,6H,1,5H2,2-3H3/b6-4- |
| InChIKey | ZZOYZZRFUISBEE-XQRVVYSFSA-N |
| XLogP | 0.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine?
The IUPAC name of (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine (CID 130373777) is (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine.
What is the SMILES notation for (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine?
The canonical SMILES for (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine is C=NC/C=C\N(C)C.
What is the InChIKey of (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine?
The InChIKey is ZZOYZZRFUISBEE-XQRVVYSFSA-N. The full InChI is InChI=1S/C6H12N2/c1-7-5-4-6-8(2)3/h4,6H,1,5H2,2-3H3/b6-4-.
What are the key properties of (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine?
(Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine has a molecular weight of 112.18 g/mol, XLogP of 0.76, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dimethyl-3-(methylideneamino)prop-1-en-1-amine is sourced from PubChem (CID 130373777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).