C21H34N4O4S — CID 130373983
7-[(2R,4S,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-ethoxy-2-methylsulfanylimidazo[2,1-f][1,2,4]triazine (PubChem CID 130373983) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is 7-[(2R,4S,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-ethoxy-2-methylsulfanylimidazo[2,1-f][1,2,4]triazine.
| Compound Name | 7-[(2R,4S,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-ethoxy-2-methylsulfanylimidazo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 130373983 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 7-[(2R,4S,5R)-4-butoxy-5-(butoxymethyl)oxolan-2-yl]-4-ethoxy-2-methylsulfanylimidazo[2,1-f][1,2,4]triazine |
| SMILES | CCCCOC[C@H]1O[C@@H](c2cnc3c(OCC)nc(SC)nn23)C[C@@H]1OCCCC |
| InChI | InChI=1S/C21H34N4O4S/c1-5-8-10-26-14-18-17(28-11-9-6-2)12-16(29-18)15-13-22-19-20(27-7-3)23-21(30-4)24-25(15)19/h13,16-18H,5-12,14H2,1-4H3/t16-,17+,18-/m1/s1 |
| InChIKey | XVALFQPDJYRTSB-FGTMMUONSA-N |
| XLogP | 4.08 |
| TPSA | 80.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|