About 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine
7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 130374007) has the molecular formula C8H6F3N3
and a molecular weight of 201.15 g/mol. Its IUPAC name is 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine.
Analyze 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine?
The IUPAC name of 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine (CID 130374007) is 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine.
What is the SMILES notation for 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine?
The canonical SMILES for 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine is FC(F)(F)C1=CCn2cnnc2C=C1.
What is the InChIKey of 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine?
The InChIKey is PVSMKXGZDWCORI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3N3/c9-8(10,11)6-1-2-7-13-12-5-14(7)4-3-6/h1-3,5H,4H2.
What are the key properties of 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine?
7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine has a molecular weight of 201.15 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-5H-[1,2,4]triazolo[4,3-a]azepine is sourced from PubChem (CID 130374007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).