C22H42N2 — CID 130374040
2-N-(2,5-dimethylhex-1-en-3-yl)-3-N-(4,4-dimethylpent-1-en-2-yl)-5-methylhex-1-ene-2,3-diamine (PubChem CID 130374040) has the molecular formula C22H42N2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 2-N-(2,5-dimethylhex-1-en-3-yl)-3-N-(4,4-dimethylpent-1-en-2-yl)-5-methylhex-1-ene-2,3-diamine.
| Compound Name | 2-N-(2,5-dimethylhex-1-en-3-yl)-3-N-(4,4-dimethylpent-1-en-2-yl)-5-methylhex-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 130374040 |
| Molecular Formula | C22H42N2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 334.33 |
| IUPAC Name | 2-N-(2,5-dimethylhex-1-en-3-yl)-3-N-(4,4-dimethylpent-1-en-2-yl)-5-methylhex-1-ene-2,3-diamine |
| SMILES | C=C(CC(C)(C)C)NC(CC(C)C)C(=C)NC(CC(C)C)C(=C)C |
| InChI | InChI=1S/C22H42N2/c1-15(2)12-20(17(5)6)24-19(8)21(13-16(3)4)23-18(7)14-22(9,10)11/h15-16,20-21,23-24H,5,7-8,12-14H2,1-4,6,9-11H3 |
| InChIKey | NNUWCXHWRRPXEB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|