C19H21F3N4 — CID 130374193
(1R,3E,5Z,7Z)-N-ethenyl-1-[6-(trifluoromethyl)-9H-[1,2,4]triazolo[4,3-a]azepin-3-yl]nona-3,5,7-trien-1-amine (PubChem CID 130374193) has the molecular formula C19H21F3N4 and a molecular weight of 362.40 g/mol. Its IUPAC name is (1R,3E,5Z,7Z)-N-ethenyl-1-[6-(trifluoromethyl)-9H-[1,2,4]triazolo[4,3-a]azepin-3-yl]nona-3,5,7-trien-1-amine.
| Compound Name | (1R,3E,5Z,7Z)-N-ethenyl-1-[6-(trifluoromethyl)-9H-[1,2,4]triazolo[4,3-a]azepin-3-yl]nona-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 130374193 |
| Molecular Formula | C19H21F3N4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (1R,3E,5Z,7Z)-N-ethenyl-1-[6-(trifluoromethyl)-9H-[1,2,4]triazolo[4,3-a]azepin-3-yl]nona-3,5,7-trien-1-amine |
| SMILES | C=CN[C@H](C/C=C/C=C\C=C/C)c1nnc2n1C=C(C(F)(F)F)C=CC2 |
| InChI | InChI=1S/C19H21F3N4/c1-3-5-6-7-8-9-12-16(23-4-2)18-25-24-17-13-10-11-15(14-26(17)18)19(20,21)22/h3-11,14,16,23H,2,12-13H2,1H3/b5-3-,7-6-,9-8+/t16-/m1/s1 |
| InChIKey | TYGHGKWVZWHTNA-LDHWOMPYSA-N |
| XLogP | 4.65 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|