C7H9N3 — CID 130374264
3-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-1,2,4-triazole (PubChem CID 130374264) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 130374264 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-1,2,4-triazole |
| SMILES | C=C/C=C\c1n[nH]c(C)n1 |
| InChI | InChI=1S/C7H9N3/c1-3-4-5-7-8-6(2)9-10-7/h3-5H,1H2,2H3,(H,8,9,10)/b5-4- |
| InChIKey | FDMPBLLAPLJBEY-PLNGDYQASA-N |
| XLogP | 1.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|