C15H26N2O2 — CID 130374317
2-amino-N-[(2S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienoxy]propan-2-yl]-2-methylpropanamide (PubChem CID 130374317) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-amino-N-[(2S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienoxy]propan-2-yl]-2-methylpropanamide.
| Compound Name | 2-amino-N-[(2S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienoxy]propan-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 130374317 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 2-amino-N-[(2S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienoxy]propan-2-yl]-2-methylpropanamide |
| SMILES | C=C/C=C\C(=C/C)COC[C@H](C)NC(=O)C(C)(C)N |
| InChI | InChI=1S/C15H26N2O2/c1-6-8-9-13(7-2)11-19-10-12(3)17-14(18)15(4,5)16/h6-9,12H,1,10-11,16H2,2-5H3,(H,17,18)/b9-8-,13-7+/t12-/m0/s1 |
| InChIKey | LBXLOXAPZJSNOF-WVRVBQHSSA-N |
| XLogP | 1.93 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|