About 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene
2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene (PubChem CID 130374340) has the molecular formula C9H12F2
and a molecular weight of 158.19 g/mol. Its IUPAC name is 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene |
| PubChem CID | 130374340 |
| Molecular Formula | C9H12F2 |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene |
| SMILES | CC(C)C1C=C(F)C(F)=CC1 |
| InChI | InChI=1S/C9H12F2/c1-6(2)7-3-4-8(10)9(11)5-7/h4-7H,3H2,1-2H3 |
| InChIKey | FUEVPHWHERZUQV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene?
The IUPAC name of 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene (CID 130374340) is 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene.
What is the SMILES notation for 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene?
The canonical SMILES for 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene is CC(C)C1C=C(F)C(F)=CC1.
What is the InChIKey of 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene?
The InChIKey is FUEVPHWHERZUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2/c1-6(2)7-3-4-8(10)9(11)5-7/h4-7H,3H2,1-2H3.
What are the key properties of 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene?
2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene has a molecular weight of 158.19 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-5-propan-2-ylcyclohexa-1,3-diene is sourced from PubChem (CID 130374340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).