C19H33N — CID 130374408
(3Z,5E)-N,6-dimethyl-9-methylidenehexadeca-3,5-dien-2-imine (PubChem CID 130374408) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is (3Z,5E)-N,6-dimethyl-9-methylidenehexadeca-3,5-dien-2-imine.
| Compound Name | (3Z,5E)-N,6-dimethyl-9-methylidenehexadeca-3,5-dien-2-imine |
|---|---|
| PubChem CID | 130374408 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | (3Z,5E)-N,6-dimethyl-9-methylidenehexadeca-3,5-dien-2-imine |
| SMILES | C=C(CCCCCCC)CC/C(C)=C/C=C\C(C)=N\C |
| InChI | InChI=1S/C19H33N/c1-6-7-8-9-10-12-17(2)15-16-18(3)13-11-14-19(4)20-5/h11,13-14H,2,6-10,12,15-16H2,1,3-5H3/b14-11-,18-13+,20-19+ |
| InChIKey | BVAAJIIRLWMKPT-UHFHCDHOSA-N |
| XLogP | 6.28 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|