C19H34N2 — CID 130374413
(7Z,9E)-7-ethyl-6-methylidene-4-methylimino-N-propan-2-yldodeca-7,9-dien-3-amine (PubChem CID 130374413) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is (7Z,9E)-7-ethyl-6-methylidene-4-methylimino-N-propan-2-yldodeca-7,9-dien-3-amine.
| Compound Name | (7Z,9E)-7-ethyl-6-methylidene-4-methylimino-N-propan-2-yldodeca-7,9-dien-3-amine |
|---|---|
| PubChem CID | 130374413 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | (7Z,9E)-7-ethyl-6-methylidene-4-methylimino-N-propan-2-yldodeca-7,9-dien-3-amine |
| SMILES | C=C(C/C(=N\C)C(CC)NC(C)C)/C(=C\C=C\CC)CC |
| InChI | InChI=1S/C19H34N2/c1-8-11-12-13-17(9-2)16(6)14-19(20-7)18(10-3)21-15(4)5/h11-13,15,18,21H,6,8-10,14H2,1-5,7H3/b12-11+,17-13-,20-19+ |
| InChIKey | PYEZTEYBOVXTEY-UBUGDMNTSA-N |
| XLogP | 5.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|