About 4-ethyl-2,3-dihydrocinnoline
4-ethyl-2,3-dihydrocinnoline (PubChem CID 130374416) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-ethyl-2,3-dihydrocinnoline.
Molecular Properties
| Compound Name | 4-ethyl-2,3-dihydrocinnoline |
| PubChem CID | 130374416 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-ethyl-2,3-dihydrocinnoline |
| SMILES | CCC1=c2ccccc2=NNC1 |
| InChI | InChI=1S/C10H12N2/c1-2-8-7-11-12-10-6-4-3-5-9(8)10/h3-6,11H,2,7H2,1H3 |
| InChIKey | BHGFAZSLXZQMJF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-2,3-dihydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,3-dihydrocinnoline?
The IUPAC name of 4-ethyl-2,3-dihydrocinnoline (CID 130374416) is 4-ethyl-2,3-dihydrocinnoline.
What is the SMILES notation for 4-ethyl-2,3-dihydrocinnoline?
The canonical SMILES for 4-ethyl-2,3-dihydrocinnoline is CCC1=c2ccccc2=NNC1.
What is the InChIKey of 4-ethyl-2,3-dihydrocinnoline?
The InChIKey is BHGFAZSLXZQMJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-8-7-11-12-10-6-4-3-5-9(8)10/h3-6,11H,2,7H2,1H3.
What are the key properties of 4-ethyl-2,3-dihydrocinnoline?
4-ethyl-2,3-dihydrocinnoline has a molecular weight of 160.22 g/mol, XLogP of 0.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,3-dihydrocinnoline is sourced from PubChem (CID 130374416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).