C27H41N3O4S — CID 130374436
[(1R,3R)-1-[4-[[2-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclopropyl]carbamoyl]-1,3-thiazol-2-yl]-4-methyl-3-[methyl(pentanoyl)amino]pentyl] acetate (PubChem CID 130374436) has the molecular formula C27H41N3O4S and a molecular weight of 503.71 g/mol. Its IUPAC name is [(1R,3R)-1-[4-[[2-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclopropyl]carbamoyl]-1,3-thiazol-2-yl]-4-methyl-3-[methyl(pentanoyl)amino]pentyl] acetate.
| Compound Name | [(1R,3R)-1-[4-[[2-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclopropyl]carbamoyl]-1,3-thiazol-2-yl]-4-methyl-3-[methyl(pentanoyl)amino]pentyl] acetate |
|---|---|
| PubChem CID | 130374436 |
| Molecular Formula | C27H41N3O4S |
| Molecular Weight | 503.71 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | [(1R,3R)-1-[4-[[2-[(2E,4Z)-hexa-2,4-dien-3-yl]cyclopropyl]carbamoyl]-1,3-thiazol-2-yl]-4-methyl-3-[methyl(pentanoyl)amino]pentyl] acetate |
| SMILES | C/C=C\C(=C/C)C1CC1NC(=O)c1csc([C@@H](C[C@H](C(C)C)N(C)C(=O)CCCC)OC(C)=O)n1 |
| InChI | InChI=1S/C27H41N3O4S/c1-8-11-13-25(32)30(7)23(17(4)5)15-24(34-18(6)31)27-29-22(16-35-27)26(33)28-21-14-20(21)19(10-3)12-9-2/h9-10,12,16-17,20-21,23-24H,8,11,13-15H2,1-7H3,(H,28,33)/b12-9-,19-10+/t20?,21?,23-,24-/m1/s1 |
| InChIKey | SRHCGGYNPRGPLS-JJWMNCQOSA-N |
| XLogP | 5.45 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|