C22H32N2S — CID 130374476
1-[(3E,5E,7Z)-5-ethenyl-2,3-dimethyldeca-1,3,5,7-tetraen-4-yl]-3-(ethenylsulfanylmethyl)-2-methylidenepiperazine (PubChem CID 130374476) has the molecular formula C22H32N2S and a molecular weight of 356.58 g/mol. Its IUPAC name is 1-[(3E,5E,7Z)-5-ethenyl-2,3-dimethyldeca-1,3,5,7-tetraen-4-yl]-3-(ethenylsulfanylmethyl)-2-methylidenepiperazine.
| Compound Name | 1-[(3E,5E,7Z)-5-ethenyl-2,3-dimethyldeca-1,3,5,7-tetraen-4-yl]-3-(ethenylsulfanylmethyl)-2-methylidenepiperazine |
|---|---|
| PubChem CID | 130374476 |
| Molecular Formula | C22H32N2S |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1-[(3E,5E,7Z)-5-ethenyl-2,3-dimethyldeca-1,3,5,7-tetraen-4-yl]-3-(ethenylsulfanylmethyl)-2-methylidenepiperazine |
| SMILES | C=CSCC1NCCN(C(/C(C=C)=C/C=C\CC)=C(\C)C(=C)C)C1=C |
| InChI | InChI=1S/C22H32N2S/c1-8-11-12-13-20(9-2)22(18(6)17(4)5)24-15-14-23-21(19(24)7)16-25-10-3/h9-13,21,23H,2-4,7-8,14-16H2,1,5-6H3/b12-11-,20-13+,22-18+ |
| InChIKey | VTXARHMGYVDVTA-NFTPWYHOSA-N |
| XLogP | 5.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|