C28H52N2 — CID 130374590
N'-ethyl-2-[(6Z,9Z,12Z,15Z)-henicosa-6,9,12,15-tetraenyl]-N-methylbutane-1,4-diamine (PubChem CID 130374590) has the molecular formula C28H52N2 and a molecular weight of 416.74 g/mol. Its IUPAC name is N'-ethyl-2-[(6Z,9Z,12Z,15Z)-henicosa-6,9,12,15-tetraenyl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-ethyl-2-[(6Z,9Z,12Z,15Z)-henicosa-6,9,12,15-tetraenyl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 130374590 |
| Molecular Formula | C28H52N2 |
| Molecular Weight | 416.74 g/mol |
| Exact Mass | 416.41 |
| IUPAC Name | N'-ethyl-2-[(6Z,9Z,12Z,15Z)-henicosa-6,9,12,15-tetraenyl]-N-methylbutane-1,4-diamine |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(CCNCC)CNC |
| InChI | InChI=1S/C28H52N2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-28(27-29-3)25-26-30-5-2/h9-10,12-13,15-16,18-19,28-30H,4-8,11,14,17,20-27H2,1-3H3/b10-9-,13-12-,16-15-,19-18- |
| InChIKey | FZWZLMNDAXMBFX-SNPVRQPZSA-N |
| XLogP | 7.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.74 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|