C30H43N3O2 — CID 130374595
N-[4-[[(8Z,11Z,14Z,17Z)-icosa-4,5,8,11,14,17-hexaenoyl]amino]butyl]-2,3-dihydropyridine-5-carboxamide (PubChem CID 130374595) has the molecular formula C30H43N3O2 and a molecular weight of 477.69 g/mol. Its IUPAC name is N-[4-[[(8Z,11Z,14Z,17Z)-icosa-4,5,8,11,14,17-hexaenoyl]amino]butyl]-2,3-dihydropyridine-5-carboxamide.
| Compound Name | N-[4-[[(8Z,11Z,14Z,17Z)-icosa-4,5,8,11,14,17-hexaenoyl]amino]butyl]-2,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 130374595 |
| Molecular Formula | C30H43N3O2 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | N-[4-[[(8Z,11Z,14Z,17Z)-icosa-4,5,8,11,14,17-hexaenoyl]amino]butyl]-2,3-dihydropyridine-5-carboxamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CC=C=CCCC(=O)NCCCCNC(=O)C1=CCCN=C1 |
| InChI | InChI=1S/C30H43N3O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-29(34)32-25-19-20-26-33-30(35)28-22-21-24-31-27-28/h3-4,6-7,9-10,12-13,15,17,22,27H,2,5,8,11,14,18-21,23-26H2,1H3,(H,32,34)(H,33,35)/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | CZSLUXHZQDOEFI-LTKCOYKYSA-N |
| XLogP | 6.09 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|