C31H50N4 — CID 130374612
N-[(6Z,9Z,12Z,15Z,18Z)-henicosa-1,6,9,12,15,18-hexaen-2-yl]-N'-[3-[(Z)-2-(methylamino)prop-1-enyl]iminobut-1-en-2-yl]ethane-1,2-diamine (PubChem CID 130374612) has the molecular formula C31H50N4 and a molecular weight of 478.77 g/mol. Its IUPAC name is N-[(6Z,9Z,12Z,15Z,18Z)-henicosa-1,6,9,12,15,18-hexaen-2-yl]-N'-[3-[(Z)-2-(methylamino)prop-1-enyl]iminobut-1-en-2-yl]ethane-1,2-diamine.
| Compound Name | N-[(6Z,9Z,12Z,15Z,18Z)-henicosa-1,6,9,12,15,18-hexaen-2-yl]-N'-[3-[(Z)-2-(methylamino)prop-1-enyl]iminobut-1-en-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 130374612 |
| Molecular Formula | C31H50N4 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.40 |
| IUPAC Name | N-[(6Z,9Z,12Z,15Z,18Z)-henicosa-1,6,9,12,15,18-hexaen-2-yl]-N'-[3-[(Z)-2-(methylamino)prop-1-enyl]iminobut-1-en-2-yl]ethane-1,2-diamine |
| SMILES | C=C(CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)NCCNC(=C)/C(C)=N/C=C(/C)NC |
| InChI | InChI=1S/C31H50N4/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-28(2)33-25-26-34-30(4)31(5)35-27-29(3)32-6/h8-9,11-12,14-15,17-18,20-21,27,32-34H,2,4,7,10,13,16,19,22-26H2,1,3,5-6H3/b9-8-,12-11-,15-14-,18-17-,21-20-,29-27-,35-31+ |
| InChIKey | CXAPKFVWNUWLFK-NYACQADKSA-N |
| XLogP | 7.66 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|