C34H51N3 — CID 130374641
1-[(6Z,9Z,12Z,15Z,18Z)-henicosa-1,6,9,12,15,18-hexaen-2-yl]-N-methyl-N-[1-(1-methyl-2H-pyridin-3-yl)ethenyl]pyrrolidin-3-amine (PubChem CID 130374641) has the molecular formula C34H51N3 and a molecular weight of 501.80 g/mol. Its IUPAC name is 1-[(6Z,9Z,12Z,15Z,18Z)-henicosa-1,6,9,12,15,18-hexaen-2-yl]-N-methyl-N-[1-(1-methyl-2H-pyridin-3-yl)ethenyl]pyrrolidin-3-amine.
| Compound Name | 1-[(6Z,9Z,12Z,15Z,18Z)-henicosa-1,6,9,12,15,18-hexaen-2-yl]-N-methyl-N-[1-(1-methyl-2H-pyridin-3-yl)ethenyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 130374641 |
| Molecular Formula | C34H51N3 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.41 |
| IUPAC Name | 1-[(6Z,9Z,12Z,15Z,18Z)-henicosa-1,6,9,12,15,18-hexaen-2-yl]-N-methyl-N-[1-(1-methyl-2H-pyridin-3-yl)ethenyl]pyrrolidin-3-amine |
| SMILES | C=C(CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)N1CCC(N(C)C(=C)C2=CC=CN(C)C2)C1 |
| InChI | InChI=1S/C34H51N3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-31(2)37-28-26-34(30-37)36(5)32(3)33-25-23-27-35(4)29-33/h7-8,10-11,13-14,16-17,19-20,23,25,27,34H,2-3,6,9,12,15,18,21-22,24,26,28-30H2,1,4-5H3/b8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | TXVJFMBBUILXKN-NEUKSRIFSA-N |
| XLogP | 8.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|