C20H35NS — CID 130374703
(3E,5Z)-2-(2,2-dimethylpentylsulfanyl)-N-ethenyl-N-ethyl-5-methylocta-3,5,7-trien-3-amine (PubChem CID 130374703) has the molecular formula C20H35NS and a molecular weight of 321.57 g/mol. Its IUPAC name is (3E,5Z)-2-(2,2-dimethylpentylsulfanyl)-N-ethenyl-N-ethyl-5-methylocta-3,5,7-trien-3-amine.
| Compound Name | (3E,5Z)-2-(2,2-dimethylpentylsulfanyl)-N-ethenyl-N-ethyl-5-methylocta-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 130374703 |
| Molecular Formula | C20H35NS |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | (3E,5Z)-2-(2,2-dimethylpentylsulfanyl)-N-ethenyl-N-ethyl-5-methylocta-3,5,7-trien-3-amine |
| SMILES | C=C/C=C(C)\C=C(/C(C)SCC(C)(C)CCC)N(C=C)CC |
| InChI | InChI=1S/C20H35NS/c1-9-13-17(5)15-19(21(11-3)12-4)18(6)22-16-20(7,8)14-10-2/h9,11,13,15,18H,1,3,10,12,14,16H2,2,4-8H3/b17-13-,19-15+ |
| InChIKey | FNASOJPFRGZWTQ-YBZIPJDPSA-N |
| XLogP | 6.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|