C15H18F2O7 — CID 130374799
(10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-yl) 2,2-difluoropropanoate (PubChem CID 130374799) has the molecular formula C15H18F2O7 and a molecular weight of 348.30 g/mol. Its IUPAC name is (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-yl) 2,2-difluoropropanoate.
| Compound Name | (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-yl) 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 130374799 |
| Molecular Formula | C15H18F2O7 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-yl) 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1CCC2(CC1)OC1OC3CC(=O)OC3C1O2 |
| InChI | InChI=1S/C15H18F2O7/c1-14(16,17)13(19)20-7-2-4-15(5-3-7)23-11-10-8(6-9(18)22-10)21-12(11)24-15/h7-8,10-12H,2-6H2,1H3 |
| InChIKey | RYJQEKFBNXUHMQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |