About 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide
1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide (PubChem CID 13037489) has the molecular formula C20H18NOPS
and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide.
Molecular Properties
| Compound Name | 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide |
| PubChem CID | 13037489 |
| Molecular Formula | C20H18NOPS |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide |
| SMILES | CSc1ccc(P2(=O)c3ccccc3CN2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18NOPS/c1-24-19-13-11-18(12-14-19)23(22)20-10-6-5-7-16(20)15-21(23)17-8-3-2-4-9-17/h2-14H,15H2,1H3 |
| InChIKey | VYAULGPLVPODRI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide?
The IUPAC name of 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide (CID 13037489) is 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide.
What is the SMILES notation for 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide?
The canonical SMILES for 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide is CSc1ccc(P2(=O)c3ccccc3CN2c2ccccc2)cc1.
What is the InChIKey of 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide?
The InChIKey is VYAULGPLVPODRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18NOPS/c1-24-19-13-11-18(12-14-19)23(22)20-10-6-5-7-16(20)15-21(23)17-8-3-2-4-9-17/h2-14H,15H2,1H3.
What are the key properties of 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide?
1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide has a molecular weight of 351.41 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylsulfanylphenyl)-2-phenyl-3H-2,1λ5-benzazaphosphole 1-oxide is sourced from PubChem (CID 13037489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).