C14H16F2O11S — CID 130375783
1,1-difluoro-2-(9-hydroxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-yl)oxy-2-oxoethanesulfonic acid (PubChem CID 130375783) has the molecular formula C14H16F2O11S and a molecular weight of 430.33 g/mol. Its IUPAC name is 1,1-difluoro-2-(9-hydroxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-yl)oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(9-hydroxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-yl)oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 130375783 |
| Molecular Formula | C14H16F2O11S |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | 1,1-difluoro-2-(9-hydroxy-10-oxospiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-4,4'-cyclohexane]-1'-yl)oxy-2-oxoethanesulfonic acid |
| SMILES | O=C1OC2C3OC4(CCC(OC(=O)C(F)(F)S(=O)(=O)O)CC4)OC3OC2C1O |
| InChI | InChI=1S/C14H16F2O11S/c15-14(16,28(20,21)22)12(19)23-5-1-3-13(4-2-5)26-9-8-7(25-11(9)27-13)6(17)10(18)24-8/h5-9,11,17H,1-4H2,(H,20,21,22) |
| InChIKey | KYBYUPPGOAWLKA-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|