C37H43F3N8OS — CID 130376130
4-methyl-1-[2-(2-prop-2-enoyl-2,8-diazaspiro[4.5]decan-8-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile (PubChem CID 130376130) has the molecular formula C37H43F3N8OS and a molecular weight of 704.87 g/mol. Its IUPAC name is 4-methyl-1-[2-(2-prop-2-enoyl-2,8-diazaspiro[4.5]decan-8-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile.
| Compound Name | 4-methyl-1-[2-(2-prop-2-enoyl-2,8-diazaspiro[4.5]decan-8-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 130376130 |
| Molecular Formula | C37H43F3N8OS |
| Molecular Weight | 704.87 g/mol |
| Exact Mass | 704.32 |
| IUPAC Name | 4-methyl-1-[2-(2-prop-2-enoyl-2,8-diazaspiro[4.5]decan-8-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
| SMILES | C=CC(=O)N1CCC2(CCN(CCn3c(C#N)cc4c(C)c(CN5CCC(Nc6ncnc7sc(CC(F)(F)F)cc67)CC5)ccc43)CC2)C1 |
| InChI | InChI=1S/C37H43F3N8OS/c1-3-33(49)47-15-10-36(23-47)8-13-45(14-9-36)16-17-48-28(21-41)18-30-25(2)26(4-5-32(30)48)22-46-11-6-27(7-12-46)44-34-31-19-29(20-37(38,39)40)50-35(31)43-24-42-34/h3-5,18-19,24,27H,1,6-17,20,22-23H2,2H3,(H,42,43,44) |
| InChIKey | NVIULTCAVOVVAW-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.87 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|