C35H39F3N8OS — CID 130376132
4-methyl-1-[2-(7-prop-2-enoyl-2,7-diazaspiro[3.4]octan-2-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile (PubChem CID 130376132) has the molecular formula C35H39F3N8OS and a molecular weight of 676.81 g/mol. Its IUPAC name is 4-methyl-1-[2-(7-prop-2-enoyl-2,7-diazaspiro[3.4]octan-2-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile.
| Compound Name | 4-methyl-1-[2-(7-prop-2-enoyl-2,7-diazaspiro[3.4]octan-2-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 130376132 |
| Molecular Formula | C35H39F3N8OS |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | 4-methyl-1-[2-(7-prop-2-enoyl-2,7-diazaspiro[3.4]octan-2-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
| SMILES | C=CC(=O)N1CCC2(CN(CCn3c(C#N)cc4c(C)c(CN5CCC(Nc6ncnc7sc(CC(F)(F)F)cc67)CC5)ccc43)C2)C1 |
| InChI | InChI=1S/C35H39F3N8OS/c1-3-31(47)45-11-8-34(21-45)19-44(20-34)12-13-46-26(17-39)14-28-23(2)24(4-5-30(28)46)18-43-9-6-25(7-10-43)42-32-29-15-27(16-35(36,37)38)48-33(29)41-22-40-32/h3-5,14-15,22,25H,1,6-13,16,18-21H2,2H3,(H,40,41,42) |
| InChIKey | DRWOABDTZKPIKX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|