C36H41F3N8OS — CID 130376135
4-methyl-1-[2-(7-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-2-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile (PubChem CID 130376135) has the molecular formula C36H41F3N8OS and a molecular weight of 690.84 g/mol. Its IUPAC name is 4-methyl-1-[2-(7-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-2-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile.
| Compound Name | 4-methyl-1-[2-(7-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-2-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 130376135 |
| Molecular Formula | C36H41F3N8OS |
| Molecular Weight | 690.84 g/mol |
| Exact Mass | 690.31 |
| IUPAC Name | 4-methyl-1-[2-(7-prop-2-enoyl-2,7-diazaspiro[3.5]nonan-2-yl)ethyl]-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
| SMILES | C=CC(=O)N1CCC2(CC1)CN(CCn1c(C#N)cc3c(C)c(CN4CCC(Nc5ncnc6sc(CC(F)(F)F)cc56)CC4)ccc31)C2 |
| InChI | InChI=1S/C36H41F3N8OS/c1-3-32(48)46-12-8-35(9-13-46)21-45(22-35)14-15-47-27(19-40)16-29-24(2)25(4-5-31(29)47)20-44-10-6-26(7-11-44)43-33-30-17-28(18-36(37,38)39)49-34(30)42-23-41-33/h3-5,16-17,23,26H,1,6-15,18,20-22H2,2H3,(H,41,42,43) |
| InChIKey | YBLHMVZGISJQRA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 93.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.84 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|