C34H41F3N8S — CID 130376143
1-[2-(2,7-diazaspiro[4.5]decan-7-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile (PubChem CID 130376143) has the molecular formula C34H41F3N8S and a molecular weight of 650.82 g/mol. Its IUPAC name is 1-[2-(2,7-diazaspiro[4.5]decan-7-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile.
| Compound Name | 1-[2-(2,7-diazaspiro[4.5]decan-7-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
|---|---|
| PubChem CID | 130376143 |
| Molecular Formula | C34H41F3N8S |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.31 |
| IUPAC Name | 1-[2-(2,7-diazaspiro[4.5]decan-7-yl)ethyl]-4-methyl-5-[[4-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]piperidin-1-yl]methyl]indole-2-carbonitrile |
| SMILES | Cc1c(CN2CCC(Nc3ncnc4sc(CC(F)(F)F)cc34)CC2)ccc2c1cc(C#N)n2CCN1CCCC2(CCNC2)C1 |
| InChI | InChI=1S/C34H41F3N8S/c1-23-24(3-4-30-28(23)15-26(18-38)45(30)14-13-44-10-2-7-33(21-44)8-9-39-20-33)19-43-11-5-25(6-12-43)42-31-29-16-27(17-34(35,36)37)46-32(29)41-22-40-31/h3-4,15-16,22,25,39H,2,5-14,17,19-21H2,1H3,(H,40,41,42) |
| InChIKey | UZGSUVKKTJNGGP-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |