C67H47FN4 — CID 130376286
2,4-bis[3-(3,5-diphenylphenyl)phenyl]-6-[4-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 130376286) has the molecular formula C67H47FN4 and a molecular weight of 927.14 g/mol. Its IUPAC name is 2,4-bis[3-(3,5-diphenylphenyl)phenyl]-6-[4-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis[3-(3,5-diphenylphenyl)phenyl]-6-[4-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130376286 |
| Molecular Formula | C67H47FN4 |
| Molecular Weight | 927.14 g/mol |
| Exact Mass | 926.38 |
| IUPAC Name | 2,4-bis[3-(3,5-diphenylphenyl)phenyl]-6-[4-fluoro-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | Fc1cc(-c2ccc3c(c2)C2CCC3C2)ncc1-c1nc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)nc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)n1 |
| InChI | InChI=1S/C67H47FN4/c68-63-41-64(51-29-30-60-49-27-28-50(33-49)61(60)40-51)69-42-62(63)67-71-65(52-25-13-23-47(31-52)58-36-54(43-15-5-1-6-16-43)34-55(37-58)44-17-7-2-8-18-44)70-66(72-67)53-26-14-24-48(32-53)59-38-56(45-19-9-3-10-20-45)35-57(39-59)46-21-11-4-12-22-46/h1-26,29-32,34-42,49-50H,27-28,33H2 |
| InChIKey | IUGRCPBWAMIUIM-UHFFFAOYSA-N |
| XLogP | 17.44 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 927.14 |
| LogP ≤ 5 | 17.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |