C40H39F3N4 — CID 130376290
2,4-bis(4-tert-butylphenyl)-6-[6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-4-(trifluoromethyl)-3-pyridinyl]-1,3,5-triazine (PubChem CID 130376290) has the molecular formula C40H39F3N4 and a molecular weight of 632.77 g/mol. Its IUPAC name is 2,4-bis(4-tert-butylphenyl)-6-[6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-4-(trifluoromethyl)-3-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-tert-butylphenyl)-6-[6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-4-(trifluoromethyl)-3-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 130376290 |
| Molecular Formula | C40H39F3N4 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.31 |
| IUPAC Name | 2,4-bis(4-tert-butylphenyl)-6-[6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-4-(trifluoromethyl)-3-pyridinyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3cnc(-c4ccc5c(c4)C4CCC5C4)cc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C40H39F3N4/c1-38(2,3)28-14-9-23(10-15-28)35-45-36(24-11-16-29(17-12-24)39(4,5)6)47-37(46-35)32-22-44-34(21-33(32)40(41,42)43)27-13-18-30-25-7-8-26(19-25)31(30)20-27/h9-18,20-22,25-26H,7-8,19H2,1-6H3 |
| InChIKey | ARGIBKHPDVQFHK-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |