C45H36F3N5O — CID 130376295
8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 130376295) has the molecular formula C45H36F3N5O and a molecular weight of 719.81 g/mol. Its IUPAC name is 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 130376295 |
| Molecular Formula | C45H36F3N5O |
| Molecular Weight | 719.81 g/mol |
| Exact Mass | 719.29 |
| IUPAC Name | 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | CC1(C)c2ccc(-c3ncc(-c4nc(-c5ccccc5)nc(-c5cccc6c5oc5ccccc56)n4)c4nc(C(F)(F)F)ccc34)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C45H36F3N5O/c1-42(2)32-21-19-26(23-33(32)43(3,4)44(42,5)6)36-29-20-22-35(45(46,47)48)50-37(29)31(24-49-36)41-52-39(25-13-8-7-9-14-25)51-40(53-41)30-17-12-16-28-27-15-10-11-18-34(27)54-38(28)30/h7-24H,1-6H3 |
| InChIKey | ZUNXAGYNLPTXDU-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.81 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |