C41H26F3N5O — CID 130376297
8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 130376297) has the molecular formula C41H26F3N5O and a molecular weight of 661.69 g/mol. Its IUPAC name is 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 130376297 |
| Molecular Formula | C41H26F3N5O |
| Molecular Weight | 661.69 g/mol |
| Exact Mass | 661.21 |
| IUPAC Name | 8-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | FC(F)(F)c1ccc2c(-c3ccc4c(c3)C3CCC4C3)ncc(-c3nc(-c4ccccc4)nc(-c4cccc5c4oc4ccccc45)n3)c2n1 |
| InChI | InChI=1S/C41H26F3N5O/c42-41(43,44)34-18-17-29-35(25-15-16-26-23-13-14-24(19-23)31(26)20-25)45-21-32(36(29)46-34)40-48-38(22-7-2-1-3-8-22)47-39(49-40)30-11-6-10-28-27-9-4-5-12-33(27)50-37(28)30/h1-12,15-18,20-21,23-24H,13-14,19H2 |
| InChIKey | SYMHFUNCYQNPGX-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.69 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |