C43H28F3N5 — CID 130376298
8-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 130376298) has the molecular formula C43H28F3N5 and a molecular weight of 671.73 g/mol. Its IUPAC name is 8-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 8-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 130376298 |
| Molecular Formula | C43H28F3N5 |
| Molecular Weight | 671.73 g/mol |
| Exact Mass | 671.23 |
| IUPAC Name | 8-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | FC(F)(F)c1ccc2c(-c3ccc4c(c3)C3CCC4C3)ncc(-c3nc(-c4cccc5ccccc45)nc(-c4cccc5ccccc45)n3)c2n1 |
| InChI | InChI=1S/C43H28F3N5/c44-43(45,46)37-20-19-34-38(28-17-18-31-26-15-16-27(21-26)35(31)22-28)47-23-36(39(34)48-37)42-50-40(32-13-5-9-24-7-1-3-11-29(24)32)49-41(51-42)33-14-6-10-25-8-2-4-12-30(25)33/h1-14,17-20,22-23,26-27H,15-16,21H2 |
| InChIKey | XHWMGDVAVHILLE-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.73 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |