C37H42F3N5 — CID 130376299
8-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-5-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine (PubChem CID 130376299) has the molecular formula C37H42F3N5 and a molecular weight of 613.77 g/mol. Its IUPAC name is 8-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-5-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine.
| Compound Name | 8-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-5-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 130376299 |
| Molecular Formula | C37H42F3N5 |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.34 |
| IUPAC Name | 8-(4,6-dicyclohexyl-1,3,5-triazin-2-yl)-5-(1,1,3,3-tetramethyl-2H-inden-5-yl)-2-(trifluoromethyl)-1,6-naphthyridine |
| SMILES | CC1(C)CC(C)(C)c2cc(-c3ncc(-c4nc(C5CCCCC5)nc(C5CCCCC5)n4)c4nc(C(F)(F)F)ccc34)ccc21 |
| InChI | InChI=1S/C37H42F3N5/c1-35(2)21-36(3,4)28-19-24(15-17-27(28)35)30-25-16-18-29(37(38,39)40)42-31(25)26(20-41-30)34-44-32(22-11-7-5-8-12-22)43-33(45-34)23-13-9-6-10-14-23/h15-20,22-23H,5-14,21H2,1-4H3 |
| InChIKey | URLROPKEHIJEGH-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |