C30H30O9 — CID 130376617
9-(1,3-benzodioxol-5-yl)-4-[(2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)oxy]-6,7-dimethoxy-3H-benzo[f][2]benzofuran-1-one (PubChem CID 130376617) has the molecular formula C30H30O9 and a molecular weight of 534.56 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-4-[(2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)oxy]-6,7-dimethoxy-3H-benzo[f][2]benzofuran-1-one.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-4-[(2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)oxy]-6,7-dimethoxy-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 130376617 |
| Molecular Formula | C30H30O9 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-4-[(2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)oxy]-6,7-dimethoxy-3H-benzo[f][2]benzofuran-1-one |
| SMILES | COc1cc2c(OC3CCC4OC(C)(C)OC4C3)c3c(c(-c4ccc5c(c4)OCO5)c2cc1OC)C(=O)OC3 |
| InChI | InChI=1S/C30H30O9/c1-30(2)38-21-8-6-16(10-25(21)39-30)37-28-18-12-23(33-4)22(32-3)11-17(18)26(27-19(28)13-34-29(27)31)15-5-7-20-24(9-15)36-14-35-20/h5,7,9,11-12,16,21,25H,6,8,10,13-14H2,1-4H3 |
| InChIKey | MOVJJHFEIVHVRW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |