C19H36N4O5S — CID 130376956
4-[[3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 130376956) has the molecular formula C19H36N4O5S and a molecular weight of 432.59 g/mol. Its IUPAC name is 4-[[3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[[3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 130376956 |
| Molecular Formula | C19H36N4O5S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 4-[[3-[2-[2-[2-(3,3-dimethylbutoxy)ethoxy]ethoxy]ethyl]triazol-4-yl]methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CC(C)(C)CCOCCOCCOCCn1nncc1CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C19H36N4O5S/c1-19(2,3)4-8-26-10-12-28-13-11-27-9-5-23-18(16-20-21-23)17-22-6-14-29(24,25)15-7-22/h16H,4-15,17H2,1-3H3 |
| InChIKey | RPQVUIYRKMTDCX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 95.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|