About 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine
1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine (PubChem CID 130377154) has the molecular formula C20H25N3O3S
and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine.
Molecular Properties
| Compound Name | 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine |
| PubChem CID | 130377154 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine |
| SMILES | CC(c1ccc2c(c1)OCC2)N1CCN(c2ccc(S(C)(=O)=O)cn2)CC1 |
| InChI | InChI=1S/C20H25N3O3S/c1-15(17-4-3-16-7-12-26-19(16)13-17)22-8-10-23(11-9-22)20-6-5-18(14-21-20)27(2,24)25/h3-6,13-15H,7-12H2,1-2H3 |
| InChIKey | MCHKNAYNASLOTB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine?
The IUPAC name of 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine (CID 130377154) is 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine.
What is the SMILES notation for 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine?
The canonical SMILES for 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine is CC(c1ccc2c(c1)OCC2)N1CCN(c2ccc(S(C)(=O)=O)cn2)CC1.
What is the InChIKey of 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine?
The InChIKey is MCHKNAYNASLOTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O3S/c1-15(17-4-3-16-7-12-26-19(16)13-17)22-8-10-23(11-9-22)20-6-5-18(14-21-20)27(2,24)25/h3-6,13-15H,7-12H2,1-2H3.
What are the key properties of 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine?
1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine has a molecular weight of 387.51 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,3-dihydro-1-benzofuran-6-yl)ethyl]-4-(5-methylsulfonyl-2-pyridinyl)piperazine is sourced from PubChem (CID 130377154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).