C25H29NO3 — CID 130377738
3-[(4-cyclopentyloxy-3-methoxyphenyl)methylamino]-5-phenylcyclohex-2-en-1-one (PubChem CID 130377738) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 3-[(4-cyclopentyloxy-3-methoxyphenyl)methylamino]-5-phenylcyclohex-2-en-1-one.
| Compound Name | 3-[(4-cyclopentyloxy-3-methoxyphenyl)methylamino]-5-phenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130377738 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 3-[(4-cyclopentyloxy-3-methoxyphenyl)methylamino]-5-phenylcyclohex-2-en-1-one |
| SMILES | COc1cc(CNC2=CC(=O)CC(c3ccccc3)C2)ccc1OC1CCCC1 |
| InChI | InChI=1S/C25H29NO3/c1-28-25-13-18(11-12-24(25)29-23-9-5-6-10-23)17-26-21-14-20(15-22(27)16-21)19-7-3-2-4-8-19/h2-4,7-8,11-13,16,20,23,26H,5-6,9-10,14-15,17H2,1H3 |
| InChIKey | SSCBNXLELPTLAT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |