C23H30N6O2 — CID 130377833
3-[4-[[(3R)-1-[(E)-4-cyclopentyloxybut-2-enoyl]piperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propanenitrile (PubChem CID 130377833) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-[4-[[(3R)-1-[(E)-4-cyclopentyloxybut-2-enoyl]piperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propanenitrile.
| Compound Name | 3-[4-[[(3R)-1-[(E)-4-cyclopentyloxybut-2-enoyl]piperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propanenitrile |
|---|---|
| PubChem CID | 130377833 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 3-[4-[[(3R)-1-[(E)-4-cyclopentyloxybut-2-enoyl]piperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propanenitrile |
| SMILES | N#CCCc1c[nH]c2ncnc(N[C@@H]3CCCN(C(=O)/C=C/COC4CCCC4)C3)c12 |
| InChI | InChI=1S/C23H30N6O2/c24-11-3-6-17-14-25-22-21(17)23(27-16-26-22)28-18-7-4-12-29(15-18)20(30)10-5-13-31-19-8-1-2-9-19/h5,10,14,16,18-19H,1-4,6-9,12-13,15H2,(H2,25,26,27,28)/b10-5+/t18-/m1/s1 |
| InChIKey | RTBRXLLIFJTEMZ-YPHWWSSASA-N |
| XLogP | 3.33 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|