About N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine
N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine (PubChem CID 130378022) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine.
Molecular Properties
| Compound Name | N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine |
| PubChem CID | 130378022 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine |
| SMILES | C=N/C(CCCCC)=C(/C)CC(=C)C |
| InChI | InChI=1S/C13H23N/c1-6-7-8-9-13(14-5)12(4)10-11(2)3/h2,5-10H2,1,3-4H3/b13-12- |
| InChIKey | YNFOVLOEPYKGKJ-SEYXRHQNSA-N |
| XLogP | 4.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine?
The IUPAC name of N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine (CID 130378022) is N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine.
What is the SMILES notation for N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine?
The canonical SMILES for N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine is C=N/C(CCCCC)=C(/C)CC(=C)C.
What is the InChIKey of N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine?
The InChIKey is YNFOVLOEPYKGKJ-SEYXRHQNSA-N. The full InChI is InChI=1S/C13H23N/c1-6-7-8-9-13(14-5)12(4)10-11(2)3/h2,5-10H2,1,3-4H3/b13-12-.
What are the key properties of N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine?
N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine has a molecular weight of 193.33 g/mol, XLogP of 4.51, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4Z)-2,4-dimethyldeca-1,4-dien-5-yl]methanimine is sourced from PubChem (CID 130378022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).