About (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate
(4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate (PubChem CID 130379761) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate.
Molecular Properties
| Compound Name | (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate |
| PubChem CID | 130379761 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate |
| SMILES | C=C1CC(COC(=O)COC)OC1=O |
| InChI | InChI=1S/C9H12O5/c1-6-3-7(14-9(6)11)4-13-8(10)5-12-2/h7H,1,3-5H2,2H3 |
| InChIKey | XNFCUAYUCUSEBX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate?
The IUPAC name of (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate (CID 130379761) is (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate.
What is the SMILES notation for (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate?
The canonical SMILES for (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate is C=C1CC(COC(=O)COC)OC1=O.
What is the InChIKey of (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate?
The InChIKey is XNFCUAYUCUSEBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O5/c1-6-3-7(14-9(6)11)4-13-8(10)5-12-2/h7H,1,3-5H2,2H3.
What are the key properties of (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate?
(4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate has a molecular weight of 200.19 g/mol, XLogP of 0.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylidene-5-oxooxolan-2-yl)methyl 2-methoxyacetate is sourced from PubChem (CID 130379761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).