About (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine
(1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine (PubChem CID 130380805) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine |
| PubChem CID | 130380805 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine |
| SMILES | [H]/N=C1\C=CC=C\C1=C\N(C)C |
| InChI | InChI=1S/C9H12N2/c1-11(2)7-8-5-3-4-6-9(8)10/h3-7,10H,1-2H3/b8-7-,10-9+ |
| InChIKey | OYHFAJZAZPPEHS-UQGDGPGGSA-N |
| XLogP | 1.58 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine?
The IUPAC name of (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine (CID 130380805) is (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine.
What is the SMILES notation for (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine?
The canonical SMILES for (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine is [H]/N=C1\C=CC=C\C1=C\N(C)C.
What is the InChIKey of (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine?
The InChIKey is OYHFAJZAZPPEHS-UQGDGPGGSA-N. The full InChI is InChI=1S/C9H12N2/c1-11(2)7-8-5-3-4-6-9(8)10/h3-7,10H,1-2H3/b8-7-,10-9+.
What are the key properties of (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine?
(1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine has a molecular weight of 148.21 g/mol, XLogP of 1.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-(6-iminocyclohexa-2,4-dien-1-ylidene)-N,N-dimethylmethanamine is sourced from PubChem (CID 130380805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).