C23H30IN3O — CID 130380830
3-[2-[iodomethyl-[(E)-3-(2-methylphenyl)prop-2-enyl]amino]ethylamino]-N-(3-methylphenyl)propanamide (PubChem CID 130380830) has the molecular formula C23H30IN3O and a molecular weight of 491.42 g/mol. Its IUPAC name is 3-[2-[iodomethyl-[(E)-3-(2-methylphenyl)prop-2-enyl]amino]ethylamino]-N-(3-methylphenyl)propanamide.
| Compound Name | 3-[2-[iodomethyl-[(E)-3-(2-methylphenyl)prop-2-enyl]amino]ethylamino]-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 130380830 |
| Molecular Formula | C23H30IN3O |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 3-[2-[iodomethyl-[(E)-3-(2-methylphenyl)prop-2-enyl]amino]ethylamino]-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)CCNCCN(CI)C/C=C/c2ccccc2C)c1 |
| InChI | InChI=1S/C23H30IN3O/c1-19-7-5-11-22(17-19)26-23(28)12-13-25-14-16-27(18-24)15-6-10-21-9-4-3-8-20(21)2/h3-11,17,25H,12-16,18H2,1-2H3,(H,26,28)/b10-6+ |
| InChIKey | WJESFKVENZPLJY-UXBLZVDNSA-N |
| XLogP | 4.63 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|