C32H36F8N2 — CID 130380925
2,2,3,3,3-pentafluoro-N-[3,3,3-trifluoro-2,2-dimethyl-1-(1,1,2,2,3,3,9,9-octamethylcyclopenta[b]fluoren-7-yl)propylidene]propanimidamide (PubChem CID 130380925) has the molecular formula C32H36F8N2 and a molecular weight of 600.64 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[3,3,3-trifluoro-2,2-dimethyl-1-(1,1,2,2,3,3,9,9-octamethylcyclopenta[b]fluoren-7-yl)propylidene]propanimidamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[3,3,3-trifluoro-2,2-dimethyl-1-(1,1,2,2,3,3,9,9-octamethylcyclopenta[b]fluoren-7-yl)propylidene]propanimidamide |
|---|---|
| PubChem CID | 130380925 |
| Molecular Formula | C32H36F8N2 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[3,3,3-trifluoro-2,2-dimethyl-1-(1,1,2,2,3,3,9,9-octamethylcyclopenta[b]fluoren-7-yl)propylidene]propanimidamide |
| SMILES | [H]/N=C(/N=C(/c1ccc2c(c1)C(C)(C)c1cc3c(cc1-2)C(C)(C)C(C)(C)C3(C)C)C(C)(C)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H36F8N2/c1-25(2)19-13-16(23(28(7,8)31(35,36)37)42-24(41)30(33,34)32(38,39)40)11-12-17(19)18-14-21-22(15-20(18)25)27(5,6)29(9,10)26(21,3)4/h11-15,41H,1-10H3/b41-24+,42-23- |
| InChIKey | WTVHAJAKCIXLBL-KWHNKCIJSA-N |
| XLogP | 10.14 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|