C42H42N4O — CID 130380942
2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-[(2E,4E)-4-phenoxyhepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazine (PubChem CID 130380942) has the molecular formula C42H42N4O and a molecular weight of 618.83 g/mol. Its IUPAC name is 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-[(2E,4E)-4-phenoxyhepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-[(2E,4E)-4-phenoxyhepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 130380942 |
| Molecular Formula | C42H42N4O |
| Molecular Weight | 618.83 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | 2-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-pyridinyl]-4-[(2E,4E)-4-phenoxyhepta-2,4,6-trien-2-yl]-6-phenyl-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C(/C)c1nc(-c2ccccc2)nc(-c2ccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)nc2)n1)Oc1ccccc1 |
| InChI | InChI=1S/C42H42N4O/c1-9-16-33(47-32-19-14-11-15-20-32)25-28(2)37-44-38(29-17-12-10-13-18-29)46-39(45-37)31-22-24-36(43-27-31)30-21-23-34-35(26-30)41(5,6)42(7,8)40(34,3)4/h9-27H,1H2,2-8H3/b28-25+,33-16+ |
| InChIKey | PABBXJRHMAHSHP-DSOADDODSA-N |
| XLogP | 10.41 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.83 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|